(4-butylphenyl)-(4-propoxyphenyl)diazene structure
|
Common Name | (4-butylphenyl)-(4-propoxyphenyl)diazene | ||
|---|---|---|---|---|
| CAS Number | 33228-21-6 | Molecular Weight | 296.40700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-butylphenyl)-(4-propoxyphenyl)diazene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H24N2O |
|---|---|
| Molecular Weight | 296.40700 |
| Exact Mass | 296.18900 |
| PSA | 33.95000 |
| LogP | 6.23340 |
| InChIKey | NFJLLYSEVCCFGP-UHFFFAOYSA-N |
| SMILES | CCCCc1ccc(N=Nc2ccc(OCCC)cc2)cc1 |
|
~%
(4-butylphenyl)... CAS#:33228-21-6 |
| Literature: Murase,K.; Watanabe,H. Bulletin of the Chemical Society of Japan, 1973 , vol. 46, p. 3142 - 3143 |
|
~%
(4-butylphenyl)... CAS#:33228-21-6 |
| Literature: Murase,K.; Watanabe,H. Bulletin of the Chemical Society of Japan, 1973 , vol. 46, p. 3142 - 3143 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| p-n-Butyl-p'-propyloxy-azobenzol |
| p-n-Butyl-p'-propoxy-azobenzol |