4-[(4-nitrophenyl)hydrazinylidene]cyclohepta-2,5-diene-1,7-dione structure
|
Common Name | 4-[(4-nitrophenyl)hydrazinylidene]cyclohepta-2,5-diene-1,7-dione | ||
|---|---|---|---|---|
| CAS Number | 33244-13-2 | Molecular Weight | 271.22800 | |
| Density | 1.39g/cm3 | Boiling Point | 430.6ºC at 760 mmHg | |
| Molecular Formula | C13H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.2ºC | |
| Name | 5-[(4-nitrophenyl)hydrazinylidene]cyclohepta-3,6-diene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 430.6ºC at 760 mmHg |
| Molecular Formula | C13H9N3O4 |
| Molecular Weight | 271.22800 |
| Flash Point | 214.2ºC |
| Exact Mass | 271.05900 |
| PSA | 107.84000 |
| LogP | 3.59920 |
| Index of Refraction | 1.649 |
| InChIKey | MDNAZUQUDCODAG-UHFFFAOYSA-N |
| SMILES | O=c1ccc(N=Nc2ccc([N+](=O)[O-])cc2)ccc1O |
|
~%
4-[(4-nitrophen... CAS#:33244-13-2 |
| Literature: Nozoe,T. et al. Bulletin of the Chemical Society of Japan, 1968 , vol. 41, p. 2978 - 2984 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-(4-nitro-phenylazo)-tropolone |
| 5-p-Nitrophenylazo-tropolon |