N-(4-methanesulfonamidophenyl)methanesulfonamide structure
|
Common Name | N-(4-methanesulfonamidophenyl)methanesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 33256-34-7 | Molecular Weight | 264.32200 | |
| Density | 1.551g/cm3 | Boiling Point | 432.9ºC at 760 mmHg | |
| Molecular Formula | C8H12N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.6ºC | |
| Name | 1,4-Bis-methacryloylamino-benzol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.551g/cm3 |
|---|---|
| Boiling Point | 432.9ºC at 760 mmHg |
| Molecular Formula | C8H12N2O4S2 |
| Molecular Weight | 264.32200 |
| Flash Point | 215.6ºC |
| Exact Mass | 264.02400 |
| PSA | 109.10000 |
| LogP | 2.73720 |
| Index of Refraction | 1.634 |
| InChIKey | RHDAIYGGSBJXBM-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)Nc1ccc(NS(C)(=O)=O)cc1 |
| HS Code | 2935009090 |
|---|
|
~%
N-(4-methanesul... CAS#:33256-34-7 |
| Literature: Adams; Nagarkatti Journal of the American Chemical Society, 1950 , vol. 72, p. 4601,4605 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N,N'-p-phenylene-bis-methanesulfonamide |
| N,N'-p-Phenylendimethansulfonamid |
| N,N'-p-Phenylen-bis-methansulfonamid |
| 1,4-Bis-methansulfonylamino-benzol |
| N,N'-dimethacryloyl 1,4-diaminobenzene |
| N,N'-p-Phenylen-bis-methacrylamid |