Fenamidone Metabolite, Pestanal
Modify Date: 2025-08-25 11:20:15
Fenamidone Metabolite, Pestanal structure
|
Common Name | Fenamidone Metabolite, Pestanal | ||
|---|---|---|---|---|
| CAS Number | 332855-88-6 | Molecular Weight | 281.30900 | |
| Density | 1.3g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H15N3O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | (5S)-3-anilino-5-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.30900 |
| Exact Mass | 281.11600 |
| PSA | 64.93000 |
| LogP | 2.13160 |
| Index of Refraction | 1.653 |
| InChIKey | KTUBSXMBPVHJQY-INIZCTEOSA-N |
| SMILES | CC1(c2ccccc2)NC(=O)N(Nc2ccccc2)C1=O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (5S)-5-Methyl-5-phenyl-3-(phenylamino)-2,4-imidazolidinedione |
| Fenamidone Metabolite |
| (S)-3-Anilino-5-methyl-5-phenylimidazolidine-2,4-dione |