3-Pentyn-1-ol,1-(4-methylbenzenesulfonate) structure
|
Common Name | 3-Pentyn-1-ol,1-(4-methylbenzenesulfonate) | ||
|---|---|---|---|---|
| CAS Number | 3329-88-2 | Molecular Weight | 238.30300 | |
| Density | 1.172g/cm3 | Boiling Point | 372.3ºC at 760mmHg | |
| Molecular Formula | C12H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.9ºC | |
| Name | pent-3-ynyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 372.3ºC at 760mmHg |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.30300 |
| Flash Point | 178.9ºC |
| Exact Mass | 238.06600 |
| PSA | 51.75000 |
| LogP | 3.19450 |
| Index of Refraction | 1.533 |
| InChIKey | KGKGDQZZMDWCRD-UHFFFAOYSA-N |
| SMILES | CC#CCCOS(=O)(=O)c1ccc(C)cc1 |
| HS Code | 2905290000 |
|---|
|
~99%
3-Pentyn-1-ol,1... CAS#:3329-88-2 |
| Literature: Fang, Fang; Vogel, Megan; Hines, Jennifer V.; Bergmeier, Stephen C. Organic and Biomolecular Chemistry, 2012 , vol. 10, # 15 p. 3080 - 3091 |
|
~%
3-Pentyn-1-ol,1... CAS#:3329-88-2 |
| Literature: Collins, Clair J.; Hanack, Michael; Stutz, Herbert; Auchter, Gerhard; Schoberth, Winfried Journal of Organic Chemistry, 1983 , vol. 48, # 26 p. 5260 - 5268 |
| Precursor 3 | |
|---|---|
| DownStream 9 | |
| HS Code | 2905290000 |
|---|---|
| Summary | 2905290000 unsaturated monohydric alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1-tosyloxy-3-pentyne |
| pent-3-yn-1-yl 4-methylbenzenesulfonate |
| Pent-3-yn-1-yl tosylate |
| 3-pentynyl tosylate |