1-benzhydrylazetidin-3-yl Methanesulfonate structure
|
Common Name | 1-benzhydrylazetidin-3-yl Methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 33301-41-6 | Molecular Weight | 317.403 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 459.9±34.0 °C at 760 mmHg | |
| Molecular Formula | C17H19NO3S | Melting Point | 111-112ºC | |
| MSDS | N/A | Flash Point | 231.9±25.7 °C | |
| Name | 1-(Diphenylmethyl)azetidin-3-yl methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 459.9±34.0 °C at 760 mmHg |
| Melting Point | 111-112ºC |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.403 |
| Flash Point | 231.9±25.7 °C |
| Exact Mass | 317.108551 |
| PSA | 54.99000 |
| LogP | 2.28 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | MSVZMUILYMLJCF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1CN(C(c2ccccc2)c2ccccc2)C1 |
| Storage condition | Room temperature. |
| HS Code | 2933990090 |
|---|
|
~97%
1-benzhydrylaze... CAS#:33301-41-6 |
| Literature: FAB PHARMA SAS; GERUSZ, Vincent; ESCAICH, Sonia; OXOBY, Mayalen; DENIS, Alexis Patent: WO2011/61214 A1, 2011 ; Location in patent: Page/Page column 85-86 ; WO 2011/061214 A1 |
|
~91%
1-benzhydrylaze... CAS#:33301-41-6 |
| Literature: Pfizer Inc. Patent: US2010/190771 A1, 2010 ; Location in patent: Page/Page column 28-29 ; |
|
~%
1-benzhydrylaze... CAS#:33301-41-6 |
| Literature: US5968923 A1, ; |
|
~%
1-benzhydrylaze... CAS#:33301-41-6 |
| Literature: Journal of Organic Chemistry, , vol. 56, # 24 p. 6729 - 6730 |
|
~%
1-benzhydrylaze... CAS#:33301-41-6 |
| Literature: WO2013/14448 A1, ; WO 2013/014448 A1 |
|
~%
1-benzhydrylaze... CAS#:33301-41-6 |
| Literature: Heterocycles, , vol. 75, # 12 p. 2981 - 2988 |
| Precursor 6 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(diphenylmethyl)azetidin-3-yl methanesulfonate |
| 1-(Diphenylmethyl)-3-azetidinyl methanesulfonate |
| 1-Benzhydryl-3-azetidinyl Methanesulfonate |
| (1-benzhydrylazetidin-3-yl) methanesulfonate |
| 1-(Diphenylmethyl)-3-(methanesulfonyloxy)azetidine |
| MFCD00159216 |
| 1-Benzhydryl-3-(methanesulfonyloxy)azetidine |
| 3-Azetidinol, 1-(diphenylmethyl)-, methanesulfonate (ester) |
| 1-Benzhydrylazetidin-3-yl methanesulfonate |
| 1-Benzhydryl-3-methanesulfonyloxy azetidine |