7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione structure
|
Common Name | 7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione | ||
|---|---|---|---|---|
| CAS Number | 33305-76-9 | Molecular Weight | 232.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H8O5 |
|---|---|
| Molecular Weight | 232.19 |
| InChIKey | XLBNQEQPMNRNLV-UHFFFAOYSA-N |
| SMILES | O=C1CCc2c1c(=O)oc1cc(O)cc(O)c21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione? |
| A: Molecular weight of 7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione is 232.19. |
| Q: What is the CAS number of 7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione? |
| A: CAS number of 7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione is 33305-76-9. |
| Q: What is the English name of 7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione? |
| A: The English name of 7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione is 7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione. |
| Q: What is the InChIKey of 7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione? |
| A: InChIKey of 7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione is XLBNQEQPMNRNLV-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione? |
| A: Molecular formula of 7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione is C12H8O5. |
| Q: What is the Chinese name of 33305-76-9? |
| A: Chinese name of 33305-76-9 is 33305-76-9. |
| Q: What is the SMILES notation of 7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione? |
| A: SMILES notation of 7,9-Dihydroxy-1,2-dihydrocyclopenta[c]chromene-3,4-dione is O=C1CCc2c1c(=O)oc1cc(O)cc(O)c21. |