BENZYL-(3-NITRO-PHENYL)-AMINE structure
|
Common Name | BENZYL-(3-NITRO-PHENYL)-AMINE | ||
|---|---|---|---|---|
| CAS Number | 33334-94-0 | Molecular Weight | 228.24700 | |
| Density | 1.258g/cm3 | Boiling Point | 379.8ºC at 760mmHg | |
| Molecular Formula | C13H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.5ºC | |
| Name | N-Benzyl-3-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 379.8ºC at 760mmHg |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.24700 |
| Flash Point | 183.5ºC |
| Exact Mass | 228.09000 |
| PSA | 57.85000 |
| LogP | 3.80310 |
| Index of Refraction | 1.658 |
| InChIKey | OVZNWAWUJPSLHM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(NCc2ccccc2)c1 |
| HS Code | 2921420090 |
|---|
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| F3097-0514 |
| N-(3-nitrophenyl)benzenemethanamine |
| N-benzyl-m-nitroaniline |
| (3-nitrophenyl)benzylamine |
| N-benzyl-3-nitrobenzenamine |
| N-benzyl-3-nitrophenylamine |
| N-(3-nitrophenyl)benzylamine |
| N-benzyl-3-nitro-aniline |