Dimethyltubocurarinium chloride
Modify Date: 2026-07-02 10:26:47
Dimethyltubocurarinium chloride structure
|
Common Name | Dimethyltubocurarinium chloride | ||
|---|---|---|---|---|
| CAS Number | 33335-58-9 | Molecular Weight | 723.725 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H48Cl2N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Dimethyltubocurarinium chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C40H48Cl2N2O6 |
|---|---|
| Molecular Weight | 723.725 |
| Exact Mass | 722.288940 |
| InChIKey | IRPSJVWFSWAZSZ-OIUSMDOTSA-L |
| SMILES | COc1ccc2cc1Oc1cc3c(cc1OC)CC[N+](C)(C)C3Cc1ccc(cc1)Oc1c(OC)c(OC)cc3c1C(C2)[N+](C)(C)CC3.[Cl-].[Cl-] |
|
Name: Antiviral activity determined as inhibition of SARS-CoV-2 induced cytotoxicity of VER...
Source: ChEMBL
Target: Severe acute respiratory syndrome coronavirus 2
External Id: CHEMBL4513082
|
|
Name: Antiviral activity determined as inhibition of SARS-CoV-2 induced cytotoxicity of Cac...
Source: ChEMBL
Target: Severe acute respiratory syndrome coronavirus 2
External Id: CHEMBL4303805
|
|
Name: SARS-CoV-2 3CL-Pro protease inhibition percentage at 20µM by FRET kind of response f...
Source: ChEMBL
Target: Replicase polyprotein 1ab
External Id: CHEMBL4495582
|
Total 3, Current Page 1 of 1
1
| O,O-Dimethyl-(+)-tubocurarine chloride |
| UNII:15BE4G33H2 |
| 1732 |
| 6,6',7',12'-Tetramethoxy-2,2,2',2'-tetramethyltubocuraran-2,2'-diium dichloride |
| METOCURINE DICHLORIDE |
| 15BE4G33H2 |
| Dimethyltubocurarinium chloride |
| metocurine chloride |
| EINECS 251-461-1 |