N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide
N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide structure
|
Common Name | N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 333383-80-5 | Molecular Weight | 319.37500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H17NO4S |
|---|---|
| Molecular Weight | 319.37500 |
| Exact Mass | 319.08800 |
| PSA | 83.06000 |
| LogP | 3.56570 |
| InChIKey | QZDHCLGWIMBBFC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(CCC=O)c2cccc(O)c2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-(3-hydroxyphe... CAS#:333383-80-5 |
| Literature: Cameron, Mark; Hoerrner, R. Scott; McNamara, James M.; Figus, Margaret; Thomas, Scott Organic Process Research and Development, 2006 , vol. 10, # 1 p. 149 - 152 |
|
~%
N-(3-hydroxyphe... CAS#:333383-80-5 |
| Literature: Cameron, Mark; Hoerrner, R. Scott; McNamara, James M.; Figus, Margaret; Thomas, Scott Organic Process Research and Development, 2006 , vol. 10, # 1 p. 149 - 152 |
|
~%
N-(3-hydroxyphe... CAS#:333383-80-5 |
| Literature: Tokuyama, Hidetoshi; Sato, Masashi; Ueda, Toshihiro; Fukuyama, Tohru Heterocycles, 2001 , vol. 54, # 1 p. 105 - 108 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 3 | |
CAS#:580-20-1
CAS#:578-67-6
CAS#:333383-93-0This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide? |
| A: Polar surface area (PSA) of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide is 83.06000. |
| Q: What is the SMILES notation of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide? |
| A: SMILES notation of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide is Cc1ccc(S(=O)(=O)N(CCC=O)c2cccc(O)c2)cc1. |
| Q: What are the downstream products of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide? |
| A: Related downstream products(CAS) of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide: 580-20-1;578-67-6;333383-93-0. |
| Q: What is the CAS number of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide? |
| A: CAS number of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide is 333383-80-5. |
| Q: What is the molecular formula of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide? |
| A: Molecular formula of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide is C16H17NO4S. |
| Q: What is the molecular weight of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide? |
| A: Molecular weight of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide is 319.37500. |
| Q: What is the LogP of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide? |
| A: LogP of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide is 3.56570. |
| Q: What is the Chinese name of 333383-80-5? |
| A: Chinese name of 333383-80-5 is 333383-80-5. |
| Q: What is the InChIKey of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide? |
| A: InChIKey of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide is QZDHCLGWIMBBFC-UHFFFAOYSA-N. |
| Q: What is the English name of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide? |
| A: The English name of N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide is N-(3-hydroxyphenyl)-4-methyl-N-(3-oxopropyl)benzenesulfonamide. |