3-bromo-5-methoxybenzofuran-2-carboxylic acid structure
|
Common Name | 3-bromo-5-methoxybenzofuran-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 333385-05-0 | Molecular Weight | 271.06400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-bromo-5-methoxy-1-benzofuran-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7BrO4 |
|---|---|
| Molecular Weight | 271.06400 |
| Exact Mass | 269.95300 |
| PSA | 59.67000 |
| LogP | 2.90210 |
| InChIKey | PUDNGQYNSJLTQM-UHFFFAOYSA-N |
| SMILES | COc1ccc2oc(C(=O)O)c(Br)c2c1 |
| HS Code | 2932999099 |
|---|
|
~94%
3-bromo-5-metho... CAS#:333385-05-0 |
| Literature: Masayuki, Inoue; Carson, Mattew W.; Frontier, Alison J.; Danishefsky, Samuel J. Journal of the American Chemical Society, 2001 , vol. 123, # 9 p. 1878 - 1889 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-bromo-2-carboxy-5-methoxybenzofuran |
| 3-BROMO-5-METHOXYBENZOFURAN-2-CARBOXYLIC ACID |