3-acetamido-6-bromo-2-nitrobenzoic acid
3-acetamido-6-bromo-2-nitrobenzoic acid structure
|
Common Name | 3-acetamido-6-bromo-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 333458-71-2 | Molecular Weight | 303.06600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7BrN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-acetamido-6-bromo-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7BrN2O5 |
|---|---|
| Molecular Weight | 303.06600 |
| Exact Mass | 301.95400 |
| PSA | 115.71000 |
| LogP | 3.18660 |
| InChIKey | ZHPNTNQVUJXJCS-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(Br)c(C(=O)O)c1[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~36%
3-acetamido-6-b... CAS#:333458-71-2 |
| Literature: Takeda Pharmaceutical Company Limited Patent: EP2098513 A1, 2009 ; Location in patent: Page/Page column 45 ; EP 2098513 A1 |
|
~%
3-acetamido-6-b... CAS#:333458-71-2 |
| Literature: Goldstein; Preitner Helvetica Chimica Acta, 1944 , vol. 27, p. 888,889 |
|
~%
3-acetamido-6-b... CAS#:333458-71-2 |
| Literature: Goldstein; Preitner Helvetica Chimica Acta, 1944 , vol. 27, p. 888,889 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:333458-73-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-acetylamino-6-bromo-2-nitro-benzoic acid |
| 6-Brom-2-nitro-3-acetamino-benzoesaeure |
| 3-Acetylamino-6-brom-2-nitro-benzoesaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 3-acetamido-6-bromo-2-nitrobenzoic acid? |
| A: Related upstream materials(CAS) of 3-acetamido-6-bromo-2-nitrobenzoic acid: 22921-67-1;537-92-8;90914-81-1. |
| Q: What is the molecular weight of 3-acetamido-6-bromo-2-nitrobenzoic acid? |
| A: Molecular weight of 3-acetamido-6-bromo-2-nitrobenzoic acid is 303.06600. |
| Q: What is the CAS number of 3-acetamido-6-bromo-2-nitrobenzoic acid? |
| A: CAS number of 3-acetamido-6-bromo-2-nitrobenzoic acid is 333458-71-2. |
| Q: What is the InChIKey of 3-acetamido-6-bromo-2-nitrobenzoic acid? |
| A: InChIKey of 3-acetamido-6-bromo-2-nitrobenzoic acid is ZHPNTNQVUJXJCS-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 333458-71-2? |
| A: Chinese name of 333458-71-2 is 333458-71-2. |
| Q: What are the downstream products of 3-acetamido-6-bromo-2-nitrobenzoic acid? |
| A: Related downstream products(CAS) of 3-acetamido-6-bromo-2-nitrobenzoic acid: 333458-73-4. |
| Q: What is the LogP of 3-acetamido-6-bromo-2-nitrobenzoic acid? |
| A: LogP of 3-acetamido-6-bromo-2-nitrobenzoic acid is 3.18660. |
| Q: What is the SMILES notation of 3-acetamido-6-bromo-2-nitrobenzoic acid? |
| A: SMILES notation of 3-acetamido-6-bromo-2-nitrobenzoic acid is CC(=O)Nc1ccc(Br)c(C(=O)O)c1[N+](=O)[O-]. |
| Q: What is the polar surface area (PSA) of 3-acetamido-6-bromo-2-nitrobenzoic acid? |
| A: Polar surface area (PSA) of 3-acetamido-6-bromo-2-nitrobenzoic acid is 115.71000. |
| Q: What English synonyms does 3-acetamido-6-bromo-2-nitrobenzoic acid have? |
| A: English synonyms of 3-acetamido-6-bromo-2-nitrobenzoic acid: 3-acetylamino-6-bromo-2-nitro-benzoic acid, 6-Brom-2-nitro-3-acetamino-benzoesaeure, 3-Acetylamino-6-brom-2-nitro-benzoesaeure. |