p-nitrophenyl dihydrogen phosphate, compound with pyridine (1:1) structure
|
Common Name | p-nitrophenyl dihydrogen phosphate, compound with pyridine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 33347-85-2 | Molecular Weight | 298.18900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11N2O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophenyl) hydrogen phosphate,pyridin-1-ium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11N2O6P |
|---|---|
| Molecular Weight | 298.18900 |
| Exact Mass | 298.03500 |
| PSA | 135.28000 |
| LogP | 2.67110 |
| InChIKey | AXOOQNKIYRASAJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OP(=O)(O)O)cc1.c1ccncc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridin-4-nitrophenyldihydrogenphosphat |
| EINECS 251-464-8 |
| pyridinium 4-nitrophenyl hydrogen phosphate |