1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone
Modify Date: 2026-07-05 08:53:56
![1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone Structure](https://www.chemsrc.com/extcaspic/046/33348-75-3.png)
1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone structure
|
Common Name | 1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 33348-75-3 | Molecular Weight | 192.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16O2 |
|---|---|
| Molecular Weight | 192.25 |
| InChIKey | LNHKZGQHYSGFCC-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(C)cc(C)c(CO)c1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 33348-75-3? |
| A: Chinese name of 33348-75-3 is 33348-75-3. |
| Q: What is the English name of 1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone? |
| A: The English name of 1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone is 1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone. |
| Q: What is the CAS number of 1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone? |
| A: CAS number of 1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone is 33348-75-3. |
| Q: What is the SMILES notation of 1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone? |
| A: SMILES notation of 1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone is CC(=O)c1c(C)cc(C)c(CO)c1C. |
| Q: What is the InChIKey of 1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone? |
| A: InChIKey of 1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone is LNHKZGQHYSGFCC-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone? |
| A: Molecular formula of 1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone is C12H16O2. |
| Q: What is the molecular weight of 1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone? |
| A: Molecular weight of 1-[3-(Hydroxymethyl)-2,4,6-trimethylphenyl]ethanone is 192.25. |