N-(cyclohexylmethylideneamino)-2,4-dinitro-aniline structure
|
Common Name | N-(cyclohexylmethylideneamino)-2,4-dinitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 3335-68-0 | Molecular Weight | 292.29100 | |
| Density | 1.42g/cm3 | Boiling Point | 456.5ºC at 760 mmHg | |
| Molecular Formula | C13H16N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.9ºC | |
| Name | N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 456.5ºC at 760 mmHg |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.29100 |
| Flash Point | 229.9ºC |
| Exact Mass | 292.11700 |
| PSA | 116.03000 |
| LogP | 4.60040 |
| Index of Refraction | 1.649 |
| InChIKey | NMXPJIFLUMFTAV-NTEUORMPSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=CC2CCCCC2)c([N+](=O)[O-])c1 |
| HS Code | 2928000090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| cyclohexylcarboxaldehyde 2,4-dinitrophenyl hydrazone |
| cyclohexanecarboxaldehyde 2,4-dinitrophenylhydrazone |
| 2,4-Dinitro-phenylhydrazon des Cyclohexan-carbaldehyd |