N-(cyclohexylmethylideneamino)-2,4-dinitro-aniline
N-(cyclohexylmethylideneamino)-2,4-dinitro-aniline structure
|
Common Name | N-(cyclohexylmethylideneamino)-2,4-dinitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 3335-68-0 | Molecular Weight | 292.29100 | |
| Density | 1.42g/cm3 | Boiling Point | 456.5ºC at 760 mmHg | |
| Molecular Formula | C13H16N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 456.5ºC at 760 mmHg |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.29100 |
| Flash Point | 229.9ºC |
| Exact Mass | 292.11700 |
| PSA | 116.03000 |
| LogP | 4.60040 |
| Index of Refraction | 1.649 |
| InChIKey | NMXPJIFLUMFTAV-NTEUORMPSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=CC2CCCCC2)c([N+](=O)[O-])c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2928000090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
CAS#:119-26-6
CAS#:3218-02-8
CAS#:2043-61-0![[cyclohexyl(triethylsilyloxy)methoxy]-triethylsilane Structure](https://image.chemsrc.com/caspic/402/530113-81-6.png)
CAS#:530113-81-6
CAS#:98-89-5
CAS#:100-49-2
CAS#:34780-92-2
CAS#:100-50-5![bicyclo[4.1.0]heptan-7-ol Structure](https://image.chemsrc.com/caspic/422/13830-44-9.png)
CAS#:13830-44-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| cyclohexylcarboxaldehyde 2,4-dinitrophenyl hydrazone |
| cyclohexanecarboxaldehyde 2,4-dinitrophenylhydrazone |
| 2,4-Dinitro-phenylhydrazon des Cyclohexan-carbaldehyd |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline? |
| A: Polar surface area (PSA) of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline is 116.03000. |
| Q: What English synonyms does N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline have? |
| A: English synonyms of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline: cyclohexylcarboxaldehyde 2,4-dinitrophenyl hydrazone, cyclohexanecarboxaldehyde 2,4-dinitrophenylhydrazone, 2,4-Dinitro-phenylhydrazon des Cyclohexan-carbaldehyd. |
| Q: What is the molecular formula of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline? |
| A: Molecular formula of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline is C13H16N4O4. |
| Q: What is the LogP of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline? |
| A: LogP of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline is 4.60040. |
| Q: What is the Chinese name of 3335-68-0? |
| A: Chinese name of 3335-68-0 is 3335-68-0. |
| Q: What is the SMILES notation of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline? |
| A: SMILES notation of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline is O=[N+]([O-])c1ccc(NN=CC2CCCCC2)c([N+](=O)[O-])c1. |
| Q: What is the boiling point of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline? |
| A: Boiling point of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline is 456.5ºC at 760 mmHg. |
| Q: What is the molecular weight of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline? |
| A: Molecular weight of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline is 292.29100. |
| Q: What is the English name of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline? |
| A: The English name of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline is N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline. |
| Q: What is the CAS number of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline? |
| A: CAS number of N-[(E)-cyclohexylmethylideneamino]-2,4-dinitroaniline is 3335-68-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |