4,6-Dimethyl-1,4-dihydro-9H-imidazo[1,2-a]purin-9-one
Modify Date: 2025-09-26 12:50:55
![4,6-Dimethyl-1,4-dihydro-9H-imidazo[1,2-a]purin-9-one Structure](https://image.chemsrc.com/caspic/420/33359-03-4.png)
4,6-Dimethyl-1,4-dihydro-9H-imidazo[1,2-a]purin-9-one structure
|
Common Name | 4,6-Dimethyl-1,4-dihydro-9H-imidazo[1,2-a]purin-9-one | ||
|---|---|---|---|---|
| CAS Number | 33359-03-4 | Molecular Weight | 203.20100 | |
| Density | 1.64g/cm3 | Boiling Point | 641.9ºC at 760mmHg | |
| Molecular Formula | C9H9N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342ºC | |
| Name | 4,6-Dimethyl-1,4-dihydro-9H-imidazo[1,2-a]purin-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 641.9ºC at 760mmHg |
| Molecular Formula | C9H9N5O |
| Molecular Weight | 203.20100 |
| Flash Point | 342ºC |
| Exact Mass | 203.08100 |
| PSA | 67.98000 |
| LogP | 0.21770 |
| Index of Refraction | 1.826 |
| InChIKey | ZLHLYESIHSHXGM-UHFFFAOYSA-N |
| SMILES | Cc1cn2c(=O)c3[nH]cnc3n(C)c2n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,4-dihydro-4,6-dimethyl-9H-imidazo<1,2-a>purin-9-one |
| 4,6-dimethyl-9-oxo-4,9-dihydro-1H-imidazo<1,2-a>purine |
| 1H-4,6-Dimethylimidazol<1,2-a>purin-9-on |