ethyl 5-(4-chlorobenzoyl)-1,4-dimethyl-1H-pyrrole-2-acetate structure
|
Common Name | ethyl 5-(4-chlorobenzoyl)-1,4-dimethyl-1H-pyrrole-2-acetate | ||
|---|---|---|---|---|
| CAS Number | 33369-30-1 | Molecular Weight | 319.78300 | |
| Density | 1.19g/cm3 | Boiling Point | 439ºC at 760mmHg | |
| Molecular Formula | C17H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.3ºC | |
| Name | ethyl 2-[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 439ºC at 760mmHg |
| Molecular Formula | C17H18ClNO3 |
| Molecular Weight | 319.78300 |
| Flash Point | 219.3ºC |
| Exact Mass | 319.09800 |
| PSA | 48.30000 |
| LogP | 3.32350 |
| Index of Refraction | 1.562 |
| InChIKey | AGKFMUXEONTGAH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1cc(C)c(C(=O)c2ccc(Cl)cc2)n1C |
| HS Code | 2933990090 |
|---|
|
~%
ethyl 5-(4-chlo... CAS#:33369-30-1 |
| Literature: McNeil Laboratories, Incorporated Patent: US3952012 A1, 1976 ; |
|
~28%
ethyl 5-(4-chlo... CAS#:33369-30-1 |
| Literature: McNeilab, Inc. Patent: US4255335 A1, 1981 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 5-p-chlorobenzoyl-1,4-dimethylpyrrole-2-acetate |