methyl [(4-nitrophenyl)sulphonyl]carbamate
Modify Date: 2025-08-28 17:08:19
![methyl [(4-nitrophenyl)sulphonyl]carbamate Structure](https://image.chemsrc.com/caspic/069/3337-70-0.png)
methyl [(4-nitrophenyl)sulphonyl]carbamate structure
|
Common Name | methyl [(4-nitrophenyl)sulphonyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 3337-70-0 | Molecular Weight | 260.22400 | |
| Density | 1.514g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl N-(4-nitrophenyl)sulfonylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.514g/cm3 |
|---|---|
| Molecular Formula | C8H8N2O6S |
| Molecular Weight | 260.22400 |
| Exact Mass | 260.01000 |
| PSA | 130.16000 |
| LogP | 2.44790 |
| Index of Refraction | 1.569 |
| InChIKey | AZXRVBPSEKZZFS-UHFFFAOYSA-N |
| SMILES | COC(=O)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2935009090 |
|---|
|
~%
methyl [(4-nitr... CAS#:3337-70-0 |
| Literature: Reed, Sean A.; Mazzotti, Anthony R.; White, M. Christina Journal of the American Chemical Society, 2009 , vol. 131, # 33 p. 11701 - 11706 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| methyl N-nosylcarbamate |
| Methyl-p-nitrobenzolsulfonylcarbamat |
| <4-Nitro-phenylsulfonyl>-methyl-carbamat |
| MB 8882 |
| EINECS 222-076-6 |