1-Pentanol,5-[(6,7,8-trimethoxy-4-quinazolinyl)amino]- structure
|
Common Name | 1-Pentanol,5-[(6,7,8-trimethoxy-4-quinazolinyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 33371-02-7 | Molecular Weight | 321.37200 | |
| Density | 1.212g/cm3 | Boiling Point | 509.8ºC at 760mmHg | |
| Molecular Formula | C16H23N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.1ºC | |
| Name | 5-[(6,7,8-trimethoxyquinazolin-4-yl)amino]pentan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 509.8ºC at 760mmHg |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.37200 |
| Flash Point | 262.1ºC |
| Exact Mass | 321.16900 |
| PSA | 85.73000 |
| LogP | 2.30310 |
| Index of Refraction | 1.594 |
| InChIKey | SSDALMNYCZFGTO-UHFFFAOYSA-N |
| SMILES | COc1cc2c(NCCCCCO)ncnc2c(OC)c1OC |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(6,7,8-trimethoxy-quinazolin-4-ylamino)-pentan-1-ol |
| denitro-KT-1 |