N-hydroxy-N-[4-(2-phenylethyl)phenyl]acetamide structure
|
Common Name | N-hydroxy-N-[4-(2-phenylethyl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 33384-03-1 | Molecular Weight | 255.31200 | |
| Density | 1.184g/cm3 | Boiling Point | 405.2ºC at 760 mmHg | |
| Molecular Formula | C16H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.8ºC | |
| Name | N-hydroxy-N-[4-(2-phenylethyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.184g/cm3 |
|---|---|
| Boiling Point | 405.2ºC at 760 mmHg |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.31200 |
| Flash Point | 198.8ºC |
| Exact Mass | 255.12600 |
| PSA | 40.54000 |
| LogP | 3.21390 |
| Index of Refraction | 1.624 |
| InChIKey | BYXRTSDCXOPEJQ-UHFFFAOYSA-N |
| SMILES | CC(=O)N(O)c1ccc(CCc2ccccc2)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-hydroxy-N-[4-... CAS#:33384-03-1 |
| Literature: Metzler,M.; Neumann,H.-G. Tetrahedron, 1971 , vol. 27, p. 2225 - 2246 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Hydroxy-4-acetylaminobibenzyl |
| N-Hydroxy-4'-phenethylacetanilide |