5-chloro-1,3-dihydroimidazo[4,5-b]pyrazin-2-one structure
|
Common Name | 5-chloro-1,3-dihydroimidazo[4,5-b]pyrazin-2-one | ||
|---|---|---|---|---|
| CAS Number | 33386-23-1 | Molecular Weight | 170.55700 | |
| Density | 1.616g/cm3 | Boiling Point | 179.2ºC at 760 mmHg | |
| Molecular Formula | C5H3ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 62.2ºC | |
| Name | 5-chloro-1,3-dihydroimidazo[4,5-b]pyrazin-2-one |
|---|
| Density | 1.616g/cm3 |
|---|---|
| Boiling Point | 179.2ºC at 760 mmHg |
| Molecular Formula | C5H3ClN4O |
| Molecular Weight | 170.55700 |
| Flash Point | 62.2ºC |
| Exact Mass | 170.00000 |
| PSA | 74.69000 |
| LogP | 0.71190 |
| Index of Refraction | 1.621 |
| InChIKey | KASKISSRRBAAQA-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2ncc(Cl)nc2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |