5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid
Modify Date: 2025-10-05 16:01:04
![5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/008/3339-84-2.png)
5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid structure
|
Common Name | 5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 3339-84-2 | Molecular Weight | 244.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5ClO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H5ClO2S2 |
|---|---|
| Molecular Weight | 244.7 |
| InChIKey | OHEOLKHLDJYUCZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccc(Cl)s2)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid? |
| A: Molecular formula of 5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid is C9H5ClO2S2. |
| Q: What is the Chinese name of 3339-84-2? |
| A: Chinese name of 3339-84-2 is 3339-84-2. |
| Q: What is the SMILES notation of 5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid? |
| A: SMILES notation of 5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid is O=C(O)c1ccc(-c2ccc(Cl)s2)s1. |
| Q: What is the CAS number of 5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid? |
| A: CAS number of 5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid is 3339-84-2. |
| Q: What is the molecular weight of 5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid? |
| A: Molecular weight of 5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid is 244.7. |
| Q: What is the InChIKey of 5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid? |
| A: InChIKey of 5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid is OHEOLKHLDJYUCZ-UHFFFAOYSA-N. |
| Q: What is the English name of 5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid? |
| A: The English name of 5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid is 5'-Chloro-[2,2'-bithiophene]-5-carboxylic acid. |