ethyl 2-[(1-adamantyl-methyl-carbamoyl)amino]propanoate structure
|
Common Name | ethyl 2-[(1-adamantyl-methyl-carbamoyl)amino]propanoate | ||
|---|---|---|---|---|
| CAS Number | 33396-49-5 | Molecular Weight | 308.41600 | |
| Density | 1.14g/cm3 | Boiling Point | 469.4ºC at 760 mmHg | |
| Molecular Formula | C17H28N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.7ºC | |
| Name | ethyl 2-[[1-adamantyl(methyl)carbamoyl]amino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 469.4ºC at 760 mmHg |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.41600 |
| Flash Point | 237.7ºC |
| Exact Mass | 308.21000 |
| PSA | 58.64000 |
| LogP | 2.93910 |
| Index of Refraction | 1.536 |
| InChIKey | BQMZASIEUOBBES-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)NC(=O)N(C)C12CC3CC(CC(C3)C1)C2 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| cc 9095 |