2-[[2-(1,3-dioxolan-2-yl)-2H-pyridin-1-yl]methyl]benzenesulfonic acid structure
|
Common Name | 2-[[2-(1,3-dioxolan-2-yl)-2H-pyridin-1-yl]methyl]benzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 3340-21-4 | Molecular Weight | 321.34800 | |
| Density | 1.408g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H15NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[[2-(1,3-dioxolan-2-yl)pyridin-1-ium-1-yl]methyl]benzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.408g/cm3 |
|---|---|
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.34800 |
| Exact Mass | 321.06700 |
| PSA | 87.92000 |
| LogP | 2.05270 |
| Index of Refraction | 1.631 |
| InChIKey | JHPRBNSICOUASP-UHFFFAOYSA-N |
| SMILES | O=S(=O)([O-])c1ccccc1C[n+]1ccccc1C1OCCO1 |
| HS Code | 2932999099 |
|---|
|
~%
2-[[2-(1,3-diox... CAS#:3340-21-4 |
| Literature: Bradsher,C.K. et al. Journal of Heterocyclic Chemistry, 1965 , vol. 2, p. 228 - 230 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-{[2-(1,3-dioxolan-2-yl)pyridinium-1-yl]methyl}benzenesulfonate |
| 1-(2-Sulfo-benzyl)-2-<1,3-dioxolanyl-(2)>-pyridiniumhydroxyd-betain |
| 2-[1,3]dioxolan-2-yl-1-(2-sulfo-benzyl)-pyridinium betaine |