Negamycin structure
|
Common Name | Negamycin | ||
|---|---|---|---|---|
| CAS Number | 33404-78-3 | Molecular Weight | 248.27900 | |
| Density | 1.303g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H20N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NegamycinA dipeptide antibiotic that inhibits the initiation of protein synthesis. |
| Name | 2-[[(3,6-diamino-5-hydroxyhexanoyl)amino]-methylamino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.303g/cm3 |
|---|---|
| Molecular Formula | C9H20N4O4 |
| Molecular Weight | 248.27900 |
| Exact Mass | 248.14800 |
| PSA | 145.40000 |
| Index of Refraction | 1.555 |
| InChIKey | IKHFJPZQZVMLRH-RNFRBKRXSA-N |
| SMILES | CN(CC(=O)O)NC(=O)CC(N)CC(O)CN |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Negamycin |
| C9H20N4O4 |