2,6-diamino-5-(2-methylbutyl)-1H-pyrimidin-4-one structure
|
Common Name | 2,6-diamino-5-(2-methylbutyl)-1H-pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 3344-04-5 | Molecular Weight | 196.25000 | |
| Density | 1.33g/cm3 | Boiling Point | 328.4ºC at 760 mmHg | |
| Molecular Formula | C9H16N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.4ºC | |
| Name | 2,6-diamino-5-(2-methylbutyl)-1H-pyrimidin-4-one |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 328.4ºC at 760 mmHg |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25000 |
| Flash Point | 152.4ºC |
| Exact Mass | 196.13200 |
| PSA | 97.79000 |
| LogP | 1.68530 |
| Index of Refraction | 1.621 |
| InChIKey | JQARGSASOXNLMD-UHFFFAOYSA-N |
| SMILES | CCC(C)Cc1c(N)nc(N)[nH]c1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |