S-methylfenitrothion structure
|
Common Name | S-methylfenitrothion | ||
|---|---|---|---|---|
| CAS Number | 3344-14-7 | Molecular Weight | 277.23400 | |
| Density | 1.368g/cm3 | Boiling Point | 383.8ºC at 760mmHg | |
| Molecular Formula | C9H12NO5PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.9ºC | |
| Name | 4-[methoxy(methylsulfanyl)phosphoryl]oxy-2-methyl-1-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.368g/cm3 |
|---|---|
| Boiling Point | 383.8ºC at 760mmHg |
| Molecular Formula | C9H12NO5PS |
| Molecular Weight | 277.23400 |
| Flash Point | 185.9ºC |
| Exact Mass | 277.01700 |
| PSA | 116.46000 |
| LogP | 3.92270 |
| Index of Refraction | 1.56 |
| InChIKey | OVDMPFAESMMFPC-UHFFFAOYSA-N |
| SMILES | COP(=O)(Oc1ccc([N+](=O)[O-])c(C)c1)SC |
| RIDADR | UN 3018 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2920190090 |
| HS Code | 2920190090 |
|---|---|
| Summary | 2920190090 other thiophosphoric esters (phosphorothioates) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Isosumithion |
| S-METHYL FENITROOXON |
| Sumithion S-isomer |
| Fenitrothion S-methyl isomer |
| Metathion,S-methyl isomer |
| 8062 HC |
| S-Methylfenitrothion |