1-ethoxy-4-[1-(4-ethoxyphenyl)propyl]benzene
Modify Date: 2025-08-25 16:48:42
![1-ethoxy-4-[1-(4-ethoxyphenyl)propyl]benzene Structure](https://image.chemsrc.com/caspic/338/33451-23-9.png)
1-ethoxy-4-[1-(4-ethoxyphenyl)propyl]benzene structure
|
Common Name | 1-ethoxy-4-[1-(4-ethoxyphenyl)propyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 33451-23-9 | Molecular Weight | 284.39300 | |
| Density | 1.002g/cm3 | Boiling Point | 398.5ºC at 760 mmHg | |
| Molecular Formula | C19H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.8ºC | |
| Name | 1-ethoxy-4-[1-(4-ethoxyphenyl)propyl]benzene |
|---|
| Density | 1.002g/cm3 |
|---|---|
| Boiling Point | 398.5ºC at 760 mmHg |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.39300 |
| Flash Point | 144.8ºC |
| Exact Mass | 284.17800 |
| PSA | 18.46000 |
| LogP | 5.02590 |
| Index of Refraction | 1.528 |
| InChIKey | FYYWDOFHPCMYRC-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(CC)c2ccc(OCC)cc2)cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |