2,4(1H,3H)-Pyrimidinedione,6-amino-5-nitro structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,6-amino-5-nitro | ||
|---|---|---|---|---|
| CAS Number | 3346-22-3 | Molecular Weight | 172.09900 | |
| Density | 1.79g/cm3 | Boiling Point | 561.7ºC at 760mmHg | |
| Molecular Formula | C4H4N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.5ºC | |
| Name | 6-amino-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.79g/cm3 |
|---|---|
| Boiling Point | 561.7ºC at 760mmHg |
| Molecular Formula | C4H4N4O4 |
| Molecular Weight | 172.09900 |
| Flash Point | 293.5ºC |
| Exact Mass | 172.02300 |
| PSA | 137.56000 |
| Index of Refraction | 1.656 |
| InChIKey | SNNFJRQZJGEAQU-UHFFFAOYSA-N |
| SMILES | Nc1[nH]c(=O)[nH]c(=O)c1[N+](=O)[O-] |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-AMINO-2,6-DIHYDROXY-5-NITROPYRIMIDINE |
| 5-Nitro-6-aminouracil |
| 6-Amino-5-nitro-1H-pyrimidin-2,4-dion |
| 6-Amino-5-nitrouracil |
| 6-Amino-5-nitro-uracil |
| 6-amino-5-nitropyrimidine-2,4-diol |