3-Nitro-2,6-pyridinediamine structure
|
Common Name | 3-Nitro-2,6-pyridinediamine | ||
|---|---|---|---|---|
| CAS Number | 3346-63-2 | Molecular Weight | 154.127 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 437.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C5H6N4O2 | Melting Point | 230℃ | |
| MSDS | N/A | Flash Point | 218.1±27.3 °C | |
| Name | 3-nitropyridine-2,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 437.0±40.0 °C at 760 mmHg |
| Melting Point | 230℃ |
| Molecular Formula | C5H6N4O2 |
| Molecular Weight | 154.127 |
| Flash Point | 218.1±27.3 °C |
| Exact Mass | 154.049072 |
| PSA | 110.75000 |
| LogP | 2.27 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.726 |
| InChIKey | TZEVSKPZTQIPLS-UHFFFAOYSA-N |
| SMILES | Nc1ccc([N+](=O)[O-])c(N)n1 |
| HS Code | 2933399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| NH2-Pyr(NO2)NH2 |
| 3-nitro-pyridine-2,6-diamine |
| 2,6-DIAMINO-3-NITROPYRIDINE |
| 3-Nitro-2,6-pyridinediamine |
| AM916 |
| 2,6-Pyridinediamine,3-nitro |
| 3-Nitro-pyridin-2,6-diyldiamin |