Tracheloside structure
|
Common Name | Tracheloside | ||
|---|---|---|---|---|
| CAS Number | 33464-71-0 | Molecular Weight | 550.552 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 769.8±60.0 °C at 760 mmHg | |
| Molecular Formula | C27H34O12 | Melting Point | 167-170℃ | |
| MSDS | N/A | Flash Point | 253.8±26.4 °C | |
Use of TrachelosideTracheloside is an antiestrogenic lignin. Tracheloside promotes keratinocyte proliferation through ERK1/2 stimulation. Tracheloside is a good candidate to promote wound healing[1]. |
| Name | 4-{[(3S,4S)-4-(3,4-Dimethoxybenzyl)-3-hydroxy-2-oxotetrahydro-3-f uranyl]methyl}-2-methoxyphenyl β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Tracheloside is an antiestrogenic lignin. Tracheloside promotes keratinocyte proliferation through ERK1/2 stimulation. Tracheloside is a good candidate to promote wound healing[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 769.8±60.0 °C at 760 mmHg |
| Melting Point | 167-170℃ |
| Molecular Formula | C27H34O12 |
| Molecular Weight | 550.552 |
| Flash Point | 253.8±26.4 °C |
| Exact Mass | 550.205017 |
| PSA | 173.60000 |
| LogP | -0.54 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | LWYAMIUSVGPFKS-CGLYQLBNSA-N |
| SMILES | COc1ccc(CC2COC(=O)C2(O)Cc2ccc(OC3OC(CO)C(O)C(O)C3O)c(OC)c2)cc1OC |
| HS Code | 29389090 |
|---|
| 2,2':6',2''-Terpyridine,4',4''''-[1,1'-biphenyl]-4,4'-diylbis |
| trachelosid |
| tracheloside |
| tpy-(ph)2-tpy |
| 2(3H)-Furanone, 4-((3,4-dimethoxyphenyl)methyl)-3-((4-(β-D-glucopyranosyloxy)-3-methoxyphenyl)methyl)dihydro-3-hydroxy-, (3S-cis)- |
| 4-{[(3S,4S)-4-(3,4-Dimethoxybenzyl)-3-hydroxy-2-oxotetrahydro-3-furanyl]methyl}-2-methoxyphenyl β-D-glucopyranoside |
| 2-hydroxyarctiin |
| 2(3H)-Furanone, 4-[(3,4-dimethoxyphenyl)methyl]-3-[[4-(β-D-glucopyranosyloxy)-3-methoxyphenyl]methyl]dihydro-3-hydroxy-, (3S,4S)- |
| 4,4'-bis-(2,2':6',2''-terpyridin-4'-yl)biphenyl |