N-diethoxyphosphoryl-N,N,2-trimethyl-propanimidamide structure
|
Common Name | N-diethoxyphosphoryl-N,N,2-trimethyl-propanimidamide | ||
|---|---|---|---|---|
| CAS Number | 3348-59-2 | Molecular Weight | 250.27500 | |
| Density | 1.06g/cm3 | Boiling Point | 288.5ºC at 760 mmHg | |
| Molecular Formula | C10H23N2O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.3ºC | |
| Name | N-Dichlorophosphinyl-1-aziridinecarboxamid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 288.5ºC at 760 mmHg |
| Molecular Formula | C10H23N2O3P |
| Molecular Weight | 250.27500 |
| Flash Point | 128.3ºC |
| Exact Mass | 250.14500 |
| PSA | 60.94000 |
| LogP | 2.78360 |
| Index of Refraction | 1.466 |
| InChIKey | PGJPZBTXCKEPEE-ZHACJKMWSA-N |
| SMILES | CCOP(=O)(N=C(C(C)C)N(C)C)OCC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| N'-Diethoxyphosphoryl-N,N-dimethyl-isobutyramidin |