N-(cyclobutylideneamino)-2,4-dinitro-aniline structure
|
Common Name | N-(cyclobutylideneamino)-2,4-dinitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 3349-70-0 | Molecular Weight | 250.21100 | |
| Density | 1.59g/cm3 | Boiling Point | 411.1ºC at 760 mmHg | |
| Molecular Formula | C10H10N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | N-(cyclobutylideneamino)-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 411.1ºC at 760 mmHg |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21100 |
| Flash Point | 202.4ºC |
| Exact Mass | 250.07000 |
| PSA | 116.03000 |
| LogP | 3.57420 |
| Index of Refraction | 1.705 |
| InChIKey | HWUYWULBKFCTDN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=C2CCC2)c([N+](=O)[O-])c1 |
| HS Code | 2928000090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| cyclobutanon-(2,4-dinitro-phenylhydrazone) |
| cyclobutanone 2,4-dinitrophenylhydrazone |
| Cyclobutanon-(2,4-dinitrophenylhydrazon) |
| 1-cyclobutylidene-2-(2,4-dinitrophenyl)hydrazine |
| N-(CYCLOBUTYLIDENEAMINO)-2,4-DINITRO-ANILINE |
| Cyclobutanon-2,4-dinitrophnylhydrazon |
| 2,4-Dinitro-phenylhydrazon des Cyclobutanon |