2-hydroxy-5-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]benzoic acid
Modify Date: 2025-11-06 17:42:27
![2-hydroxy-5-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]benzoic acid Structure](https://image.chemsrc.com/caspic/427/33494-96-1.png)
2-hydroxy-5-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]benzoic acid structure
|
Common Name | 2-hydroxy-5-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 33494-96-1 | Molecular Weight | 298.29000 | |
| Density | 1.326g/cm3 | Boiling Point | 558.3ºC at 760 mmHg | |
| Molecular Formula | C17H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.2ºC | |
| Name | 2-hydroxy-5-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.326g/cm3 |
|---|---|
| Boiling Point | 558.3ºC at 760 mmHg |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29000 |
| Flash Point | 209.2ºC |
| Exact Mass | 298.08400 |
| PSA | 83.83000 |
| LogP | 2.99510 |
| Index of Refraction | 1.656 |
| InChIKey | VQHPMNQHSCDLLS-XBXARRHUSA-N |
| SMILES | COc1ccc(C=CC(=O)c2ccc(O)c(C(=O)O)c2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-Methoxycinnamoylsalicylic acid |
| Salicylic acid,p-methoxycinnamate |