1,1,1-trichloro-heptafluoro-butane
1,1,1-trichloro-heptafluoro-butane structure
|
Common Name | 1,1,1-trichloro-heptafluoro-butane | ||
|---|---|---|---|---|
| CAS Number | 335-49-9 | Molecular Weight | 287.39100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4Cl3F7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,1-trichloro-heptafluoro-butane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C4Cl3F7 |
|---|---|
| Molecular Weight | 287.39100 |
| Exact Mass | 285.89500 |
| LogP | 4.18950 |
| InChIKey | HCRLMIMQLZJAEG-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(Cl)(Cl)Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:355-23-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1,1-Trichlor-heptafluor-butan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,1,1-trichloro-heptafluoro-butane? |
| A: The English name of 1,1,1-trichloro-heptafluoro-butane is 1,1,1-trichloro-heptafluoro-butane. |
| Q: What is the SMILES notation of 1,1,1-trichloro-heptafluoro-butane? |
| A: SMILES notation of 1,1,1-trichloro-heptafluoro-butane is FC(F)(F)C(F)(F)C(F)(F)C(Cl)(Cl)Cl. |
| Q: What is the Chinese name of 335-49-9? |
| A: Chinese name of 335-49-9 is 335-49-9. |
| Q: What is the LogP of 1,1,1-trichloro-heptafluoro-butane? |
| A: LogP of 1,1,1-trichloro-heptafluoro-butane is 4.18950. |
| Q: What English synonyms does 1,1,1-trichloro-heptafluoro-butane have? |
| A: English synonyms of 1,1,1-trichloro-heptafluoro-butane: 1,1,1-Trichlor-heptafluor-butan. |
| Q: What is the CAS number of 1,1,1-trichloro-heptafluoro-butane? |
| A: CAS number of 1,1,1-trichloro-heptafluoro-butane is 335-49-9. |
| Q: What is the InChIKey of 1,1,1-trichloro-heptafluoro-butane? |
| A: InChIKey of 1,1,1-trichloro-heptafluoro-butane is HCRLMIMQLZJAEG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,1,1-trichloro-heptafluoro-butane? |
| A: Molecular formula of 1,1,1-trichloro-heptafluoro-butane is C4Cl3F7. |
| Q: What are the downstream products of 1,1,1-trichloro-heptafluoro-butane? |
| A: Related downstream products(CAS) of 1,1,1-trichloro-heptafluoro-butane: 355-23-7. |
| Q: What is the molecular weight of 1,1,1-trichloro-heptafluoro-butane? |
| A: Molecular weight of 1,1,1-trichloro-heptafluoro-butane is 287.39100. |