undecafluorohexanoyl chloride
Modify Date: 2025-08-25 14:52:51
undecafluorohexanoyl chloride structure
|
Common Name | undecafluorohexanoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 335-53-5 | Molecular Weight | 332.49900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6ClF11O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | undecafluorohexanoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6ClF11O |
|---|---|
| Molecular Weight | 332.49900 |
| Exact Mass | 331.94600 |
| PSA | 17.07000 |
| LogP | 3.85530 |
| InChIKey | CUPWBYQOIFVEGA-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2915900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:141478-84-4
CAS#:307-24-4
CAS#:65440-93-9| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| perfluorohexanoyl chloride |