7-methoxy-9-oxoxanthene-2-carboxylic acid structure
|
Common Name | 7-methoxy-9-oxoxanthene-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 33510-07-5 | Molecular Weight | 270.23700 | |
| Density | 1.421g/cm3 | Boiling Point | 512.3ºC at 760 mmHg | |
| Molecular Formula | C15H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.4ºC | |
| Name | 7-methoxy-9-oxoxanthene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.421g/cm3 |
|---|---|
| Boiling Point | 512.3ºC at 760 mmHg |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.23700 |
| Flash Point | 199.4ºC |
| Exact Mass | 270.05300 |
| PSA | 76.74000 |
| LogP | 2.65300 |
| Index of Refraction | 1.647 |
| InChIKey | UFLPEZUZTHLBJE-UHFFFAOYSA-N |
| SMILES | COc1ccc2oc3ccc(C(=O)O)cc3c(=O)c2c1 |
| HS Code | 2932999099 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| AH 6556 |
| 7-methoxy-9-oxo-xanthene-2-carboxylic acid |
| 7-methoxy-9-oxo-9h-xanthene-2-carboxylic acid |
| 2-Carboxy-7-methoxyxanthen-9-one |