1,1'-Biphenyl,4,4'',4'''',4''''''-silanetetrayltetrakis- structure
|
Common Name | 1,1'-Biphenyl,4,4'',4'''',4''''''-silanetetrayltetrakis- | ||
|---|---|---|---|---|
| CAS Number | 3352-54-3 | Molecular Weight | 640.88500 | |
| Density | 1.19g/cm3 | Boiling Point | 746.6ºC at 760 mmHg | |
| Molecular Formula | C48H36Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 393.7ºC | |
| Name | tetrakis(4-phenylphenyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 746.6ºC at 760 mmHg |
| Molecular Formula | C48H36Si |
| Molecular Weight | 640.88500 |
| Flash Point | 393.7ºC |
| Exact Mass | 640.25900 |
| LogP | 9.73200 |
| Index of Refraction | 1.704 |
| InChIKey | ABITWCWTLOLPCV-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2ccc([Si](c3ccc(-c4ccccc4)cc3)(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3)cc2)cc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Tetrakis-biphenyl-4-yl-silan |
| tetrabiphenyl-4-ylsilane |
| tetrakis-biphenyl-4-yl-silane |
| Tetra-p-biphenylylsilan |