3-nitro-4-piperazin-1-ylbenzamide
Modify Date: 2025-10-06 12:55:09
3-nitro-4-piperazin-1-ylbenzamide structure
|
Common Name | 3-nitro-4-piperazin-1-ylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 335210-46-3 | Molecular Weight | 250.25400 | |
| Density | 1.329g/cm3 | Boiling Point | 446.8ºC at 760 mmHg | |
| Molecular Formula | C11H14N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224ºC | |
| Name | 3-nitro-4-piperazin-1-ylbenzamide |
|---|
| Density | 1.329g/cm3 |
|---|---|
| Boiling Point | 446.8ºC at 760 mmHg |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.25400 |
| Flash Point | 224ºC |
| Exact Mass | 250.10700 |
| PSA | 104.18000 |
| LogP | 1.72060 |
| Index of Refraction | 1.61 |
| InChIKey | RBCKMJVVNSKJSK-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(N2CCNCC2)c([N+](=O)[O-])c1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |