4-Iodo-5-methyl-2-nitro-phenylamine
4-Iodo-5-methyl-2-nitro-phenylamine structure
|
Common Name | 4-Iodo-5-methyl-2-nitro-phenylamine | ||
|---|---|---|---|---|
| CAS Number | 335349-58-1 | Molecular Weight | 278.04700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-Iodo-5-methyl-2-nitro-phenylamine (Chinese name: 4-碘-5-甲基-2-硝基安替比林, CAS number: 335349-58-1), molecular formula C7H7IN2O2, molecular weight 278.04700, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-iodo-5-methyl-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H7IN2O2 |
|---|---|
| Molecular Weight | 278.04700 |
| Exact Mass | 277.95500 |
| PSA | 71.84000 |
| LogP | 3.19440 |
| InChIKey | DLAZSRKCQDQBPC-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)c([N+](=O)[O-])cc1I |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~88%
4-Iodo-5-methyl... CAS#:335349-58-1 |
| Literature: Britton, Doyle; Noland, Wayland E.; Pinnow, Matthew J.; Young Jr., Victor G. Helvetica Chimica Acta, 2003 , vol. 86, # 4 p. 1175 - 1192 |
|
~%
4-Iodo-5-methyl... CAS#:335349-58-1 |
| Literature: Ishikawa; Saegusa; Inamura; Sakuma; Ashida Journal of Medicinal Chemistry, 1985 , vol. 28, # 10 p. 1387 - 1393 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-iodo-5-methyl-2-nitro-phenylamine |
| Benzenamine,4-iodo-5-methyl-2-nitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-iodo-5-methyl-2-nitroaniline? |
| A: CAS number of 4-iodo-5-methyl-2-nitroaniline is 335349-58-1. |
| Q: What English synonyms does 4-iodo-5-methyl-2-nitroaniline have? |
| A: English synonyms of 4-iodo-5-methyl-2-nitroaniline: 4-iodo-5-methyl-2-nitro-phenylamine, Benzenamine,4-iodo-5-methyl-2-nitro. |
| Q: What is the molecular formula of 4-iodo-5-methyl-2-nitroaniline? |
| A: Molecular formula of 4-iodo-5-methyl-2-nitroaniline is C7H7IN2O2. |
| Q: What is the molecular weight of 4-iodo-5-methyl-2-nitroaniline? |
| A: Molecular weight of 4-iodo-5-methyl-2-nitroaniline is 278.04700. |
| Q: What is the SMILES notation of 4-iodo-5-methyl-2-nitroaniline? |
| A: SMILES notation of 4-iodo-5-methyl-2-nitroaniline is Cc1cc(N)c([N+](=O)[O-])cc1I. |
| Q: What is the InChIKey of 4-iodo-5-methyl-2-nitroaniline? |
| A: InChIKey of 4-iodo-5-methyl-2-nitroaniline is DLAZSRKCQDQBPC-UHFFFAOYSA-N. |
| Q: What is the English name of 4-iodo-5-methyl-2-nitroaniline? |
| A: The English name of 4-iodo-5-methyl-2-nitroaniline is 4-iodo-5-methyl-2-nitroaniline. |
| Q: What is the polar surface area (PSA) of 4-iodo-5-methyl-2-nitroaniline? |
| A: Polar surface area (PSA) of 4-iodo-5-methyl-2-nitroaniline is 71.84000. |
| Q: What is the Chinese name of 335349-58-1? |
| A: Chinese name of 335349-58-1 is 335349-58-1. |
| Q: What is the LogP of 4-iodo-5-methyl-2-nitroaniline? |
| A: LogP of 4-iodo-5-methyl-2-nitroaniline is 3.19440. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |