Venturicidin B structure
|
Common Name | Venturicidin B | ||
|---|---|---|---|---|
| CAS Number | 33538-72-6 | Molecular Weight | 706.94600 | |
| Density | 1.14g/cm3 | Boiling Point | 823.4ºC at 760 mmHg | |
| Molecular Formula | C40H66O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.9ºC | |
Use of Venturicidin BVenturicidin B (Aabomycin A2) is a macrolide antibiotic isolated from Streptomyces sp., used as an antifungal agent, a potent inhibitor of the mitochondrial F0-ATP synthase complex[1]. |
| Name | Venturicidin |
|---|---|
| Synonym | More Synonyms |
| Description | Venturicidin B (Aabomycin A2) is a macrolide antibiotic isolated from Streptomyces sp., used as an antifungal agent, a potent inhibitor of the mitochondrial F0-ATP synthase complex[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 823.4ºC at 760 mmHg |
| Molecular Formula | C40H66O10 |
| Molecular Weight | 706.94600 |
| Flash Point | 240.9ºC |
| Exact Mass | 706.46600 |
| PSA | 151.98000 |
| LogP | 5.94110 |
| Index of Refraction | 1.538 |
| InChIKey | VIOYQVOQUWWSAB-KEXSXYLYSA-N |
| SMILES | CCC(=O)C(C)C(O)C(C)CC(C)C1OC(=O)CC2(O)CC=C(C)C(O2)C(C)=CCCCC(OC2CC(O)C(O)C(C)O2)C=CC(C)CC1C |
| Velloquercetin |