(E)-3-(2-methoxy-5-nitro-phenyl)prop-2-enal structure
|
Common Name | (E)-3-(2-methoxy-5-nitro-phenyl)prop-2-enal | ||
|---|---|---|---|---|
| CAS Number | 33538-92-0 | Molecular Weight | 207.18300 | |
| Density | 1.266g/cm3 | Boiling Point | 393.8ºC at 760 mmHg | |
| Molecular Formula | C10H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.8ºC | |
| Name | (E)-3-(2-methoxy-5-nitrophenyl)prop-2-enal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 393.8ºC at 760 mmHg |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.18300 |
| Flash Point | 193.8ºC |
| Exact Mass | 207.05300 |
| PSA | 72.12000 |
| LogP | 2.33870 |
| Index of Refraction | 1.594 |
| InChIKey | QBMUNVBXMCDJGG-NSCUHMNNSA-N |
| SMILES | COc1ccc([N+](=O)[O-])cc1C=CC=O |
|
~%
(E)-3-(2-methox... CAS#:33538-92-0 |
| Literature: Billman; Tonnis Journal of pharmaceutical sciences, 1971 , vol. 60, # 8 p. 1188 - 1192 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Nitro-2-methoxyzimtaldehyd |