[4-chloro-2-(3-oxoprop-1-enyl)phenyl] acetate structure
|
Common Name | [4-chloro-2-(3-oxoprop-1-enyl)phenyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 33538-95-3 | Molecular Weight | 224.64000 | |
| Density | 1.266g/cm3 | Boiling Point | 373.6ºC at 760 mmHg | |
| Molecular Formula | C11H9ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.8ºC | |
| Name | [4-chloro-2-[(Z)-3-oxoprop-1-enyl]phenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 373.6ºC at 760 mmHg |
| Molecular Formula | C11H9ClO3 |
| Molecular Weight | 224.64000 |
| Flash Point | 162.8ºC |
| Exact Mass | 224.02400 |
| PSA | 43.37000 |
| LogP | 2.47740 |
| Index of Refraction | 1.574 |
| InChIKey | CSUFXMZCPYMCLR-IHWYPQMZSA-N |
| SMILES | CC(=O)Oc1ccc(Cl)cc1C=CC=O |
|
~%
[4-chloro-2-(3-... CAS#:33538-95-3 |
| Literature: Billman; Tonnis Journal of pharmaceutical sciences, 1971 , vol. 60, # 8 p. 1188 - 1192 |
| 5-Chlor-2.4-difluor-benzolsulfonsaeure-amid |
| 5-chloro-2,4-difluorobenzenesulphonamide |
| 5-Chlor-2-acetoxyzimtaldehyd |