6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one
6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one structure
|
Common Name | 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 33544-18-2 | Molecular Weight | 248.62500 | |
| Density | 1.666g/cm3 | Boiling Point | 464.2ºC at 760 mmHg | |
| Molecular Formula | C10H5ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.666g/cm3 |
|---|---|
| Boiling Point | 464.2ºC at 760 mmHg |
| Molecular Formula | C10H5ClN4O2 |
| Molecular Weight | 248.62500 |
| Flash Point | 234.6ºC |
| Exact Mass | 248.01000 |
| PSA | 84.67000 |
| LogP | 1.62650 |
| Index of Refraction | 1.702 |
| InChIKey | OXVXNMWLJXQXFC-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2nn[nH]n2)oc2ccc(Cl)cc12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2934999090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
6-Chloro-2-(2H-... CAS#:33544-18-2 |
| Literature: Ellis; Shaw Journal of medicinal chemistry, 1972 , vol. 15, # 8 p. 865 - 867 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(Tetrazol-5-yl)-6-chlor-chromon |
| 6-chloro-2-(1H-tetrazol-5-yl)-chromen-4-one |
| 6-Bromo-2-(1H-tetrazol-5-yl)-4H-1-benzopyran-4-one |
| 4H-1-Benzopyran-4-one,6-bromo-2-(1H-tetrazol-5-yl) |
| 6-bromo-2-(2h-tetrazol-5-yl)-4h-chromen-4-one |
| 2-(Tetrazol-5-yl)-6-brom-chromon |
| 6-bromo-2-(1H-tetrazol-5-yl)-chromen-4-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one? |
| A: InChIKey of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one is OXVXNMWLJXQXFC-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 33544-18-2? |
| A: Chinese name of 33544-18-2 is 33544-18-2. |
| Q: What is the LogP of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one? |
| A: LogP of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one is 1.62650. |
| Q: What is the CAS number of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one? |
| A: CAS number of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one is 33544-18-2. |
| Q: What is the boiling point of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one? |
| A: Boiling point of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one is 464.2ºC at 760 mmHg. |
| Q: What is the molecular weight of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one? |
| A: Molecular weight of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one is 248.62500. |
| Q: What English synonyms does 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one have? |
| A: English synonyms of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one: 2-(Tetrazol-5-yl)-6-chlor-chromon, 6-chloro-2-(1H-tetrazol-5-yl)-chromen-4-one, 6-Bromo-2-(1H-tetrazol-5-yl)-4H-1-benzopyran-4-one, 4H-1-Benzopyran-4-one,6-bromo-2-(1H-tetrazol-5-yl), 6-bromo-2-(2h-tetrazol-5-yl)-4h-chromen-4-one, 2-(Tetrazol-5-yl)-6-brom-chromon, 6-bromo-2-(1H-tetrazol-5-yl)-chromen-4-one. |
| Q: What is the molecular formula of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one? |
| A: Molecular formula of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one is C10H5ClN4O2. |
| Q: What is the English name of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one? |
| A: The English name of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one is 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one. |
| Q: What is the polar surface area (PSA) of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one? |
| A: Polar surface area (PSA) of 6-Chloro-2-(2H-tetrazol-5-yl)-4H-chromen-4-one is 84.67000. |