dicyano (1Z,10Z)-N,N'-dinitro-2,9-dioxodecanediimidothioate structure
|
Common Name | dicyano (1Z,10Z)-N,N'-dinitro-2,9-dioxodecanediimidothioate | ||
|---|---|---|---|---|
| CAS Number | 33551-84-7 | Molecular Weight | 400.39000 | |
| Density | 1.522g/cm3 | Boiling Point | 623.495ºC at 760 mmHg | |
| Molecular Formula | C12H12N6O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.878ºC | |
| Name | dicyano (1Z,10Z)-N,N'-dinitro-2,9-dioxodecanediimidothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.522g/cm3 |
|---|---|
| Boiling Point | 623.495ºC at 760 mmHg |
| Molecular Formula | C12H12N6O6S2 |
| Molecular Weight | 400.39000 |
| Flash Point | 330.878ºC |
| Exact Mass | 400.02600 |
| PSA | 248.68000 |
| LogP | 3.12056 |
| Index of Refraction | 1.654 |
| InChIKey | YOQMIEXVLKPZFV-NFLUSIDLSA-N |
| SMILES | N#CSC(=N[N+](=O)[O-])C(=O)CCCCCCC(=O)C(=N[N+](=O)[O-])SC#N |
| HS Code | 2930909090 |
|---|
|
~%
dicyano (1Z,10Z... CAS#:33551-84-7 |
| Literature: Fridman,A.L.; Ismagilova,G.S. Journal of Organic Chemistry USSR (English Translation), 1972 , vol. 8, p. 1856 - 1861 Zhurnal Organicheskoi Khimii, 1972 , vol. 8, p. 1809 - 1816 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,12-bis-Rodanid-5,8-dinitro-diazadodecandion-2,11 |