bromomethyl-[bromomethyl(dimethyl)silyl]-dimethylsilane structure
|
Common Name | bromomethyl-[bromomethyl(dimethyl)silyl]-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 33558-73-5 | Molecular Weight | 304.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H16Br2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bromomethyl-[bromomethyl(dimethyl)silyl]-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H16Br2Si2 |
|---|---|
| Molecular Weight | 304.17000 |
| Exact Mass | 301.91600 |
| LogP | 4.18640 |
| InChIKey | LITFSLRRXLUFIC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CBr)[Si](C)(C)CBr |
|
~92%
bromomethyl-[br... CAS#:33558-73-5 |
| Literature: Block, Eric; Dikarev, Evgeny V.; Glass, Richard S.; Jin, Jin; Li, Bo; Li, Xiaojie; Zhang, Shao-Zhong Journal of the American Chemical Society, 2006 , vol. 128, # 46 p. 14949 - 14961 |
|
~%
bromomethyl-[br... CAS#:33558-73-5 |
| Literature: Tamao,K.; Kumada,M. Journal of Organometallic Chemistry, 1971 , vol. 30, p. 329 - 337 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,2-bis-bromomethyl-1,1,2,2-tetramethyl-disilane |