methyl 3-(5-bromo-2-methoxy-phenyl)oxirane-2-carboxylate
Modify Date: 2025-08-25 19:27:46
methyl 3-(5-bromo-2-methoxy-phenyl)oxirane-2-carboxylate structure
|
Common Name | methyl 3-(5-bromo-2-methoxy-phenyl)oxirane-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 33567-55-4 | Molecular Weight | 287.10700 | |
| Density | 1.541g/cm3 | Boiling Point | 329.5ºC at 760 mmHg | |
| Molecular Formula | C11H11BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.1ºC | |
| Name | methyl 3-(5-bromo-2-methoxyphenyl)oxirane-2-carboxylate |
|---|
| Density | 1.541g/cm3 |
|---|---|
| Boiling Point | 329.5ºC at 760 mmHg |
| Molecular Formula | C11H11BrO4 |
| Molecular Weight | 287.10700 |
| Flash Point | 153.1ºC |
| Exact Mass | 285.98400 |
| PSA | 48.06000 |
| LogP | 2.07060 |
| Index of Refraction | 1.564 |
| InChIKey | SCVONOFKCNSWGM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1OC1c1cc(Br)ccc1OC |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:33567-61-2| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |