methyl 3-(3,5-dichloro-2-methoxy-phenyl)oxirane-2-carboxylate
Modify Date: 2025-09-23 15:20:54
methyl 3-(3,5-dichloro-2-methoxy-phenyl)oxirane-2-carboxylate structure
|
Common Name | methyl 3-(3,5-dichloro-2-methoxy-phenyl)oxirane-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 33567-58-7 | Molecular Weight | 277.10100 | |
| Density | 1.428g/cm3 | Boiling Point | 336.8ºC at 760 mmHg | |
| Molecular Formula | C11H10Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.1ºC | |
| Name | methyl 3-(3,5-dichloro-2-methoxyphenyl)oxirane-2-carboxylate |
|---|
| Density | 1.428g/cm3 |
|---|---|
| Boiling Point | 336.8ºC at 760 mmHg |
| Molecular Formula | C11H10Cl2O4 |
| Molecular Weight | 277.10100 |
| Flash Point | 136.1ºC |
| Exact Mass | 275.99600 |
| PSA | 48.06000 |
| LogP | 2.61490 |
| Index of Refraction | 1.559 |
| InChIKey | FTOYPHSRTPHZPU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1OC1c1cc(Cl)cc(Cl)c1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |