diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane
![diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane Structure](https://image.chemsrc.com/caspic/013/33575-75-6.png)
diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane structure
|
Common Name | diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 33575-75-6 | Molecular Weight | 310.37300 | |
| Density | 1.242g/cm3 | Boiling Point | 383.7ºC at 760 mmHg | |
| Molecular Formula | C10H19N2O3PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.9ºC | |
Summary: The Chinese name is not provided, the English name is diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane, with CAS number 33575-75-6 and molecular formula C10H19N2O3PS2. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 383.7ºC at 760 mmHg |
| Molecular Formula | C10H19N2O3PS2 |
| Molecular Weight | 310.37300 |
| Flash Point | 185.9ºC |
| Exact Mass | 310.05700 |
| PSA | 124.58000 |
| LogP | 4.37430 |
| Index of Refraction | 1.536 |
| InChIKey | OLCFBQMTJJRJHA-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SCc1nnc(C(C)C)o1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
diethoxy-[(5-pr... CAS#:33575-75-6 |
| Literature: Ruefenacht,K. Helvetica Chimica Acta, 1972 , vol. 55, p. 1979 - 1986 |
|
~%
diethoxy-[(5-pr... CAS#:33575-75-6 |
| Literature: Ruefenacht,K. Helvetica Chimica Acta, 1972 , vol. 55, p. 1979 - 1986 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane? |
| A: SMILES notation of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane is CCOP(=S)(OCC)SCc1nnc(C(C)C)o1. |
| Q: What is the English name of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane? |
| A: The English name of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane is diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane. |
| Q: What is the Chinese name of 33575-75-6? |
| A: Chinese name of 33575-75-6 is 33575-75-6. |
| Q: What is the boiling point of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane? |
| A: Boiling point of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane is 383.7ºC at 760 mmHg. |
| Q: What is the InChIKey of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane? |
| A: InChIKey of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane is OLCFBQMTJJRJHA-UHFFFAOYSA-N. |
| Q: What are the upstream materials of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane? |
| A: Related upstream materials(CAS) of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane: 1925-73-1;3914-46-3;3454-66-8. |
| Q: What is the LogP of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane? |
| A: LogP of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane is 4.37430. |
| Q: What is the molecular weight of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane? |
| A: Molecular weight of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane is 310.37300. |
| Q: What is the polar surface area (PSA) of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane? |
| A: Polar surface area (PSA) of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane is 124.58000. |
| Q: What is the CAS number of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane? |
| A: CAS number of diethoxy-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane is 33575-75-6. |