1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride
1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride structure
|
Common Name | 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 33575-76-7 | Molecular Weight | 315.85900 | |
| Density | 1.274g/cm3 | Boiling Point | 375.2ºC at 760 mmHg | |
| Molecular Formula | C15H22ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.7ºC | |
Summary: 1-(4-Methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one hydrochloride (CAS号：33575-76-7), molecular formula C15H22ClNO2S, molecular weight 315.85900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 375.2ºC at 760 mmHg |
| Molecular Formula | C15H22ClNO2S |
| Molecular Weight | 315.85900 |
| Flash Point | 180.7ºC |
| Exact Mass | 315.10600 |
| PSA | 56.59000 |
| LogP | 4.08830 |
| Index of Refraction | 1.543 |
| InChIKey | HBUVEAGWKZFIFO-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SCc1nnc(CC)o1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-(4-methylsulf... CAS#:33575-76-7 |
| Literature: Ruefenacht,K. Helvetica Chimica Acta, 1972 , vol. 55, p. 1979 - 1986 |
|
~%
1-(4-methylsulf... CAS#:33575-76-7 |
| Literature: Ruefenacht,K. Helvetica Chimica Acta, 1972 , vol. 55, p. 1979 - 1986 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4'-Methylsulfinyl-3-piperidinopropiophenone hydrochloride |
| Propiophenone,4'-methylsulfinyl-3-piperidino-,hydrochloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride? |
| A: Molecular weight of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride is 315.85900. |
| Q: What is the Chinese name of 33575-76-7? |
| A: Chinese name of 33575-76-7 is 33575-76-7. |
| Q: What is the polar surface area (PSA) of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride? |
| A: Polar surface area (PSA) of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride is 56.59000. |
| Q: What is the molecular formula of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride? |
| A: Molecular formula of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride is C15H22ClNO2S. |
| Q: What English synonyms does 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride have? |
| A: English synonyms of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride: 4'-Methylsulfinyl-3-piperidinopropiophenone hydrochloride, Propiophenone,4'-methylsulfinyl-3-piperidino-,hydrochloride. |
| Q: What are the upstream materials of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride? |
| A: Related upstream materials(CAS) of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride: 38090-72-1;3914-45-2;3454-66-8. |
| Q: What is the English name of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride? |
| A: The English name of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride is 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride. |
| Q: What is the boiling point of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride? |
| A: Boiling point of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride is 375.2ºC at 760 mmHg. |
| Q: What is the InChIKey of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride? |
| A: InChIKey of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride is HBUVEAGWKZFIFO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride? |
| A: SMILES notation of 1-(4-methylsulfinylphenyl)-3-piperidin-1-ylpropan-1-one,hydrochloride is CCOP(=S)(OCC)SCc1nnc(CC)o1. |